Introduction：Basic information about CAS 26444-72-4|tris[(dimethylamino)methyl]phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tris[(dimethylamino)methyl]phenol |
|---|
| CAS Number | 26444-72-4 | Molecular Weight | 265.39400 |
|---|
| Density | 1.063g/cm3 | Boiling Point | 399.7ºC at 760 mmHg |
|---|
| Molecular Formula | C15H27N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 195.5ºC |
|---|
Names
| Name | 2,3,4-tris[(dimethylamino)methyl]phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.063g/cm3 |
|---|
| Boiling Point | 399.7ºC at 760 mmHg |
|---|
| Molecular Formula | C15H27N3O |
|---|
| Molecular Weight | 265.39400 |
|---|
| Flash Point | 195.5ºC |
|---|
| Exact Mass | 265.21500 |
|---|
| PSA | 29.95000 |
|---|
| LogP | 1.57700 |
|---|
| Vapour Pressure | 5.82E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.554 |
|---|
| InChIKey | CIPOCPJRYUFXLL-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)Cc1ccc(O)c(CN(C)C)c1CN(C)C |
|---|
Synonyms
| 2,3,4-tris(dimethylaminomethyl)phenol |
| EINECS 247-695-9 |
| Phenol,tris[(dimethylamino)methyl] |
| Tris((dimethylamino)methyl)phenol |
