Introduction：Basic information about CAS 26471-45-4|1,3-bis(ethenyl)benzene,buta-1,3-diene,styrene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-bis(ethenyl)benzene,buta-1,3-diene,styrene |
|---|
| CAS Number | 26471-45-4 | Molecular Weight | 288.42600 |
|---|
| Density | / | Boiling Point | 211.3ºC at 760mmHg |
|---|
| Molecular Formula | C22H24 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 74.6ºC |
|---|
Names
| Name | 1,3-bis(ethenyl)benzene,buta-1,3-diene,styrene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 211.3ºC at 760mmHg |
|---|
| Molecular Formula | C22H24 |
|---|
| Molecular Weight | 288.42600 |
|---|
| Flash Point | 74.6ºC |
|---|
| Exact Mass | 288.18800 |
|---|
| LogP | 6.66060 |
|---|
| InChIKey | WREGNPCWXFCVRF-UHFFFAOYSA-N |
|---|
| SMILES | C=CC=C.C=Cc1cccc(C=C)c1.C=Cc1ccccc1 |
|---|
Synonyms
| Butadiene,styrene,divinylbenzene polymer |
| 1,3-divinylbenzene |
| Benzene,1,3-diethenyl-,polymer with 1,3-butadiene and ethenylbenzene |
