Introduction：Basic information about CAS 201810-35-7|4-(2-Boc-amino-pyridin-4-yl)-benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(2-Boc-amino-pyridin-4-yl)-benzoic acid |
|---|
| CAS Number | 201810-35-7 | Molecular Weight | 314.33600 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 456.388ºC at 760 mmHg |
|---|
| Molecular Formula | C17H18N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 229.816ºC |
|---|
Names
| Name | 4-[3-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]pyridin-4-yl]benzoic acid |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 456.388ºC at 760 mmHg |
|---|
| Molecular Formula | C17H18N2O4 |
|---|
| Molecular Weight | 314.33600 |
|---|
| Flash Point | 229.816ºC |
|---|
| Exact Mass | 314.12700 |
|---|
| PSA | 102.51000 |
|---|
| LogP | 3.56550 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.603 |
|---|
| InChIKey | DHCAXKOGPSACBW-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)c1nccc(-c2ccc(C(=O)O)cc2)c1N |
|---|
