Introduction：Basic information about CAS 20988-85-6|3-phenyl-4-thioxo-3,4-dihydrophthalazine-1-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-phenyl-4-thioxo-3,4-dihydrophthalazine-1-carboxylic acid |
|---|
| CAS Number | 20988-85-6 | Molecular Weight | 282.317 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 491.0±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H10N2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 250.8±24.0 °C |
|---|
Names
| Name | 3-phenyl-4-sulfanylidenephthalazine-1-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 491.0±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H10N2O2S |
|---|
| Molecular Weight | 282.317 |
|---|
| Flash Point | 250.8±24.0 °C |
|---|
| Exact Mass | 282.046295 |
|---|
| PSA | 87.21000 |
|---|
| LogP | 2.32 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.699 |
|---|
| InChIKey | KNXTVOBGGOILAT-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1nn(-c2ccccc2)c(=S)c2ccccc12 |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| 1-Phthalazinecarboxylic acid, 3,4-dihydro-3-phenyl-4-thioxo- |
| 3-phenyl-4-thioxo-3,4-dihydrophthalazine-1-carboxylic acid |
| QC-3682 |
| RW3995 |
| 3-Phenyl-4-thioxo-3,4-dihydro-1-phthalazinecarboxylic acid |
