Introduction：Basic information about CAS 874289-23-3|[2-Fluoro-4-(methylcarbamoyl)phenyl]boronic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [2-Fluoro-4-(methylcarbamoyl)phenyl]boronic acid |
|---|
| CAS Number | 874289-23-3 | Molecular Weight | 196.971 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H9BFNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | [2-fluoro-4-(methylcarbamoyl)phenyl]boronic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Molecular Formula | C8H9BFNO3 |
|---|
| Molecular Weight | 196.971 |
|---|
| Exact Mass | 197.065948 |
|---|
| PSA | 73.05000 |
|---|
| LogP | 0.53 |
|---|
| Index of Refraction | 1.534 |
|---|
| InChIKey | STYRVOIKGOQNAD-UHFFFAOYSA-N |
|---|
| SMILES | CNC(=O)c1ccc(B(O)O)c(F)c1 |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| [2-Fluoro-4-(methylcarbamoyl)phenyl]boronic acid |
| Boronic acid, B-[2-fluoro-4-[(methylamino)carbonyl]phenyl]- |
