Introduction：Basic information about CAS 3034-94-4|3-Nitrophenylacetylene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Nitrophenylacetylene |
|---|
| CAS Number | 3034-94-4 | Molecular Weight | 147.131 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 238.1±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H5NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 105.9±15.4 °C |
|---|
Names
| Name | 1-ethynyl-3-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 238.1±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H5NO2 |
|---|
| Molecular Weight | 147.131 |
|---|
| Flash Point | 105.9±15.4 °C |
|---|
| Exact Mass | 147.032028 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 2.13 |
|---|
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.580 |
|---|
| InChIKey | JOUOQPWPDONKKS-UHFFFAOYSA-N |
|---|
| SMILES | C#Cc1cccc([N+](=O)[O-])c1 |
|---|
Synonyms
| 3-ethynylnitrobenzene |
| 1-Ethynyl-3-nitrobenzene |
| 3-Nitrophenylacetylene |
| Benzene, 1-ethynyl-3-nitro- |
| m-nitrophenylacetylene |
| 1-Aethinyl-3-nitro-benzol |
| 1-ethynyl-3-nitro-benzene |
| 3-Nitrophenylethyne |
| Benzene,1-ethynyl-3-nitro |
