Introduction:Basic information about CAS 216394-05-7|5-Bromo-6-chloropyridine-3-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Bromo-6-chloropyridine-3-sulfonyl chloride |
|---|
| CAS Number | 216394-05-7 | Molecular Weight | 290.950 |
|---|
| Density | 2.0±0.1 g/cm3 | Boiling Point | 352.8±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C5H2BrCl2NO2S | Melting Point | 71-73°C |
|---|
| MSDS | USA | Flash Point | 167.2±27.9 °C |
|---|
Names
| Name | 5-Bromo-6-chloropyridine-3-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.0±0.1 g/cm3 |
|---|
| Boiling Point | 352.8±42.0 °C at 760 mmHg |
|---|
| Melting Point | 71-73°C |
|---|
| Molecular Formula | C5H2BrCl2NO2S |
|---|
| Molecular Weight | 290.950 |
|---|
| Flash Point | 167.2±27.9 °C |
|---|
| Exact Mass | 288.836670 |
|---|
| PSA | 55.41000 |
|---|
| LogP | 3.13 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.604 |
|---|
| InChIKey | TURGMVYIESHZBE-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1cnc(Cl)c(Br)c1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| RIDADR | 3261 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-bromo-6-chloro-pyridine-3-sulfonyl chloride |
| 3-BROMO-2-CHLOROPYRIDINE-5-SULPHONYL CHLORIDE |
| 2-chloro-3-bromopyridin-5-ylsulfonyl chloride |
| MFCD01318107 |
| 3-Pyridinesulfonyl chloride, 5-bromo-6-chloro- |
| 3-bromo-2-chloropyridine-5-sulfonyl chloride |
| 5-Bromo-6-chloro-3-pyridinesulfonyl chloride |
| pyridine-3-bromo-2-chloro-5-sulphonyl chloride |
| 5-Brom-6-chlor-pyridin-3-sulfonylchlorid |
| 5-bromo-6-chloropyridine-3-sulfonyl chloride |