Introduction：Basic information about CAS 84435-79-0|2,6-dibromo-4-(diaminomethylidene)cyclohexa-2,5-dien-1-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-dibromo-4-(diaminomethylidene)cyclohexa-2,5-dien-1-one |
|---|
| CAS Number | 84435-79-0 | Molecular Weight | 293.94300 |
|---|
| Density | 2.21g/cm3 | Boiling Point | 318.6ºC at 760 mmHg |
|---|
| Molecular Formula | C7H6Br2N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 146.5ºC |
|---|
Names
| Name | 2,6-dibromo-4-(diaminomethylidene)cyclohexa-2,5-dien-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.21g/cm3 |
|---|
| Boiling Point | 318.6ºC at 760 mmHg |
|---|
| Molecular Formula | C7H6Br2N2O |
|---|
| Molecular Weight | 293.94300 |
|---|
| Flash Point | 146.5ºC |
|---|
| Exact Mass | 291.88500 |
|---|
| PSA | 70.10000 |
|---|
| LogP | 3.00130 |
|---|
| Index of Refraction | 1.713 |
|---|
| InChIKey | YBEICZXHUUCERA-UHFFFAOYSA-N |
|---|
| SMILES | N=C(N)c1cc(Br)c(O)c(Br)c1 |
|---|
Safety Information
Customs
| HS Code | 2925290090 |
|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 3,5-Dibrom-4-hydroxy-benzamidin |
| 3,5-Dibromo-4-hydroxy-benzamidine |
| Benzenecarboximidamide,3,5-dibromo-4-hydroxy |
| 4-amidino-2,6-dibromophenol |
