Introduction：Basic information about CAS 871948-92-4|3-phenylacrylic acid (2r,3s)-3-dibenzylamino-2-hydroxybutyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-phenylacrylic acid (2r,3s)-3-dibenzylamino-2-hydroxybutyl ester |
|---|
| CAS Number | 871948-92-4 | Molecular Weight | 415.52400 |
|---|
| Density | 1.155g/cm3 | Boiling Point | 586.018ºC at 760 mmHg |
|---|
| Molecular Formula | C27H29NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 308.213ºC |
|---|
Names
| Name | 3-phenylacrylic acid (2r,3s)-3-dibenzylamino-2-hydroxybutyl ester |
|---|
Chemical & Physical Properties
| Density | 1.155g/cm3 |
|---|
| Boiling Point | 586.018ºC at 760 mmHg |
|---|
| Molecular Formula | C27H29NO3 |
|---|
| Molecular Weight | 415.52400 |
|---|
| Flash Point | 308.213ºC |
|---|
| Exact Mass | 415.21500 |
|---|
| PSA | 49.77000 |
|---|
| LogP | 4.69480 |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | FTPFDUPCPIJWBQ-SRWHSLIMSA-N |
|---|
| SMILES | CC(C(O)COC(=O)C=Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
|---|
