Introduction:Basic information about CAS 216581-76-9|3-Hydroxy-1-adamantyl acrylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Hydroxy-1-adamantyl acrylate |
|---|
| CAS Number | 216581-76-9 | Molecular Weight | 222.280 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 314.2±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H18O3 | Melting Point | 72 °C |
|---|
| MSDS | / | Flash Point | 128.1±15.9 °C |
|---|
Names
| Name | (3-hydroxy-1-adamantyl) prop-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 314.2±25.0 °C at 760 mmHg |
|---|
| Melting Point | 72 °C |
|---|
| Molecular Formula | C13H18O3 |
|---|
| Molecular Weight | 222.280 |
|---|
| Flash Point | 128.1±15.9 °C |
|---|
| Exact Mass | 222.125595 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 1.92 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.553 |
|---|
| InChIKey | DKDKCSYKDZNMMA-UHFFFAOYSA-N |
|---|
| SMILES | C=CC(=O)OC12CC3CC(CC(O)(C3)C1)C2 |
|---|
Safety Information
Customs
| HS Code | 2916129000 |
|---|
| Summary | 2916129000 other esters of acrylic acid VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 1-acryloyloxy-3-hydroxyadamantane |
| acrylic acid 3-hydroxyadamantane-1-yl |
| Acrylic Acid 3-Hydroxy-1-adamantyl Ester |
| 2-Propenoic acid, 3-hydroxytricyclo[3.3.1.1]dec-1-yl ester |
| 3-Hydroxyadamantan-1-yl acrylate |
| HADMA |
| acrylic acid 3-hydroxy-1-adamantyl |
| 2-Propenoic acid, (5R,7S)-3-hydroxytricyclo[3.3.1.1]dec-1-yl ester |
| 3-hydroxyadamantan-1-yl prop-2-enoate |
| (1s,3r,5R,7S)-3-Hydroxyadamantan-1-yl acrylate |
| 1-acryloyloxy-3-adamantanol |
| 1,3-Adamantanediol monoacrylate |
| 3-Hydroxy-1-adamantyl Acrylate |