Introduction：Basic information about CAS 6786-83-0|Solvent Blue 4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Solvent Blue 4 |
|---|
| CAS Number | 6786-83-0 | Molecular Weight | 487.63500 |
|---|
| Density | 1.199 | Boiling Point | 682.7ºC at 760 mmHg |
|---|
| Molecular Formula | C33H33N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 366.7ºC |
|---|
Names
| Name | Solvent Blue 4 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.199 |
|---|
| Boiling Point | 682.7ºC at 760 mmHg |
|---|
| Molecular Formula | C33H33N3O |
|---|
| Molecular Weight | 487.63500 |
|---|
| Flash Point | 366.7ºC |
|---|
| Exact Mass | 487.26200 |
|---|
| PSA | 38.74000 |
|---|
| LogP | 7.07260 |
|---|
| Index of Refraction | 1.699 |
|---|
| InChIKey | WNDULEJVCPEASN-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1ccc(C(O)(c2ccc(N(C)C)cc2)c2ccc(Nc3ccccc3)c3ccccc23)cc1 |
|---|
Synonyms
| Baso Blue 645 |
| Blue 645 |
| [4-(anilino)naphthalen-1-yl]-bis[4-(dimethylamino)phenyl]methanol |
| [4-(anilino)-1-naphthyl]-bis[4-(dimethylamino)phenyl]methanol |
| Oil Violet 4B |
| Victoria Blue base |
| bis[4-(dimethylamino)phenyl]-[4-(phenylamino)naphthalen-1-yl]methanol |
