Introduction：Basic information about CAS 4273-88-5|Naphtazol JLE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Naphtazol JLE |
|---|
| CAS Number | 4273-88-5 | Molecular Weight | 278.32700 |
|---|
| Density | 1.325g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C13H14N2O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-oxobutanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.325g/cm3 |
|---|
| Molecular Formula | C13H14N2O3S |
|---|
| Molecular Weight | 278.32700 |
|---|
| Exact Mass | 278.07300 |
|---|
| PSA | 96.53000 |
|---|
| LogP | 2.68560 |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | GXFGVXXEQKKDGE-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1ccc2nc(NC(=O)CC(C)=O)sc2c1 |
|---|
Safety Information
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Naphtoelan |
| N-(6-Aethoxy-benzothiazol-2-yl)-acetoacetamid |
| Butanamide,N-(6-ethoxy-2-benzothiazolyl)-3-oxo |
| Naphtazol JLE |
| Naphtol AS-L4G |
| Amanil Naphthol AS-L4G |
| Daito Grounder L4G |
| Cibanaphthol LT4G |
| Naphthol AS-L 4G |
| N-(6-ethoxy-2-benzothiazolyl)-3-oxobutanamide |
| Azoic coupling component 9 |
| N-(6-ethoxy-benzothiazol-2-yl)-acetoacetamide |
