Introduction:Basic information about CAS 153197-14-9|oxaziclomefone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | oxaziclomefone |
|---|
| CAS Number | 153197-14-9 | Molecular Weight | 376.27600 |
|---|
| Density | 1.277 g/cm3 | Boiling Point | 518.6ºC at 760 mmHg |
|---|
| Molecular Formula | C20H19Cl2NO2 | Melting Point | 149.5-150.5ºC |
|---|
| MSDS | / | Flash Point | 267.5ºC |
|---|
Names
| Name | oxaziclomefone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.277 g/cm3 |
|---|
| Boiling Point | 518.6ºC at 760 mmHg |
|---|
| Melting Point | 149.5-150.5ºC |
|---|
| Molecular Formula | C20H19Cl2NO2 |
|---|
| Molecular Weight | 376.27600 |
|---|
| Flash Point | 267.5ºC |
|---|
| Exact Mass | 375.07900 |
|---|
| PSA | 29.54000 |
|---|
| LogP | 5.41390 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | FCOHEOSCARXMMS-UHFFFAOYSA-N |
|---|
| SMILES | CC1=C(c2ccccc2)C(=O)N(C(C)(C)c2cc(Cl)cc(Cl)c2)CO1 |
|---|
Synonyms
| Oxaziclomefone |
| 3-[1-(3,5-dichlorophenyl)-1-methylethyl]-2,3-dihydro-6-methyl-5-phenyl-4H-1,3-oxazin-4-one |
| Oxaziclomefone [ISO] |
| 3-[1-(3,5-dichlorophenyl)-1-methylethyl]-3,4-dihydro-6-methyl-5-phenyl-2H-1,3-oxazin-4-one |
| 3-[2-(3,5-dichlorophenyl)propan-2-yl]-6-methyl-5-phenyl-3,4-dihydro-2H-1,3-oxazin-4-one |
| UNII-6O05VST8NA |
| 3-[2-(3,5-dichlorophenyl)propan-2-yl]-6-methyl-5-phenyl-2H-1,3-oxazin-4-one |