Introduction:Basic information about CAS 2035-72-5|4-Benzoyl-3-hydroxyphenyl methacrylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Benzoyl-3-hydroxyphenyl methacrylate |
|---|
| CAS Number | 2035-72-5 | Molecular Weight | 282.291 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 437.4±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H14O4 | Melting Point | 77-79°C |
|---|
| MSDS | / | Flash Point | 160.1±20.3 °C |
|---|
Names
| Name | (4-benzoyl-3-hydroxyphenyl) 2-methylprop-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 437.4±38.0 °C at 760 mmHg |
|---|
| Melting Point | 77-79°C |
|---|
| Molecular Formula | C17H14O4 |
|---|
| Molecular Weight | 282.291 |
|---|
| Flash Point | 160.1±20.3 °C |
|---|
| Exact Mass | 282.089203 |
|---|
| PSA | 63.60000 |
|---|
| LogP | 4.17 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.590 |
|---|
| InChIKey | IMNBHNRXUAJVQE-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)C(=O)Oc1ccc(C(=O)c2ccccc2)c(O)c1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
Synonyms
| 2-Hydroxy-4-benzoylphenylmethacrylat |
| 3-Hydroxy-4-(phenylcarbonyl)phenyl-2-methylprop-2-enoat |
| 3-Hydroxy-4-benzoylphenylester v. Metacrylsaeure |
| EINECS 218-000-6 |
| 4-methacryloxy-2-hydroxy-benzophenone |
| MFCD00080561 |
| 2-methyl-2-propenoic acid,4-benzoyl-3-hydroxyphenyl ester |
| 3-hydroxy-4-(phenylcarbonyl)phenyl 2-methylprop-2-enoate |
| 2-Propenoic acid, 2-methyl-, 4-benzoyl-3-hydroxyphenyl ester |
| 4-Benzoyl-3-hydroxyphenyl methacrylate |