Introduction：Basic information about CAS 38119-08-3|3-benzoylnaphthalene-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-benzoylnaphthalene-2-carboxylic acid |
|---|
| CAS Number | 38119-08-3 | Molecular Weight | 276.28600 |
|---|
| Density | 1.289g/cm3 | Boiling Point | 497.8ºC at 760mmHg |
|---|
| Molecular Formula | C18H12O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 269ºC |
|---|
Names
| Name | 3-benzoylnaphthalene-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.289g/cm3 |
|---|
| Boiling Point | 497.8ºC at 760mmHg |
|---|
| Molecular Formula | C18H12O3 |
|---|
| Molecular Weight | 276.28600 |
|---|
| Flash Point | 269ºC |
|---|
| Exact Mass | 276.07900 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 3.76900 |
|---|
| Index of Refraction | 1.678 |
|---|
| InChIKey | GDYNSPPOLCIHSP-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc2ccccc2cc1C(=O)c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| EINECS 253-786-4 |
| 3-benzoyl-2-naphthalenecarboxylic acid |
| 3-Benzoyl-2-naphthalincarbonsaeure |
| 3-Benzoyl-naphthalin-2-carbonsaeure |
| 3-Benzoyl-2-naphthoic acid |
| 3-Benzoyl-<2>naphthoesaeure |
