Introduction:Basic information about CAS 5465-13-4|dinitrodurene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dinitrodurene |
|---|
| CAS Number | 5465-13-4 | Molecular Weight | 224.21300 |
|---|
| Density | 1.258g/cm3 | Boiling Point | 363.4ºC at 760mmHg |
|---|
| Molecular Formula | C10H12N2O4 | Melting Point | 210 °C |
|---|
| MSDS | / | Flash Point | 172.9ºC |
|---|
Names
| Name | 1,2,4,5-tetramethyl-3,6-dinitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.258g/cm3 |
|---|
| Boiling Point | 363.4ºC at 760mmHg |
|---|
| Melting Point | 210 °C |
|---|
| Molecular Formula | C10H12N2O4 |
|---|
| Molecular Weight | 224.21300 |
|---|
| Flash Point | 172.9ºC |
|---|
| Exact Mass | 224.08000 |
|---|
| PSA | 91.64000 |
|---|
| LogP | 3.78300 |
|---|
| Index of Refraction | 1.572 |
|---|
| InChIKey | AEPQXGFMAZTUEA-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(C)c([N+](=O)[O-])c(C)c(C)c1[N+](=O)[O-] |
|---|
Safety Information
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | S37/39-S26 |
|---|
| RTECS | TJ3490000 |
|---|
| HS Code | 2904209090 |
|---|
Customs
| HS Code | 2904209090 |
|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 2,3,5,6-tetramethyl-1,4-dinitrobenzene |
| 3,2,4,5-tetramethylbenzene |
| 1,2,4,5-tetramethyl-3,6-dinitro-benzene |
| 3,6-dinitrodurene |
| Dinitrodurene |
| 1,4-Dinitro-2,3,5,6-tetramethyl-benzen |
| EINECS 226-766-8 |
| MFCD00007164 |