Introduction：Basic information about CAS 54864-61-8|MECLOZOLIN, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | MECLOZOLIN |
|---|
| CAS Number | 54864-61-8 | Molecular Weight | 304.12600 |
|---|
| Density | 1.419g/cm3 | Boiling Point | 386.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11Cl2NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 187.6ºC |
|---|
Names
| Name | myclozolin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.419g/cm3 |
|---|
| Boiling Point | 386.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11Cl2NO4 |
|---|
| Molecular Weight | 304.12600 |
|---|
| Flash Point | 187.6ºC |
|---|
| Exact Mass | 303.00700 |
|---|
| PSA | 55.84000 |
|---|
| LogP | 2.94670 |
|---|
| Index of Refraction | 1.559 |
|---|
| InChIKey | FTCOKXNKPOUEFH-UHFFFAOYSA-N |
|---|
| SMILES | COCC1(C)OC(=O)N(c2cc(Cl)cc(Cl)c2)C1=O |
|---|
Synonyms
| rac-(5R)-3-(3,5-dichlorophenyl)-5-(methoxymethyl)-5-methyl-1,3-oxazolidine-2,4-dione |
| EINECS 259-379-8 |
| 3-(3,5-dichlorophenyl)-5-(methoxymethyl)-5-methyl-2,4-oxazolidinedione |
| (RS)-3-(3,5-dichlorophenyl)-5-methoxymethyl-5-methyl-1,3-oxazolidine-2,4-dione |
| Myclozolin |
| 3-(3,5-dichlorophenyl)-5-(methoxymethyl)-5-methyl-1,3-oxazolidine-2,4-dione |
