Introduction：Basic information about CAS 1228-53-1|Bis(3-nitrophenyl)sulfone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis(3-nitrophenyl)sulfone |
|---|
| CAS Number | 1228-53-1 | Molecular Weight | 308.267 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 525.8±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H8N2O6S | Melting Point | 252-255°C |
|---|
| MSDS | / | Flash Point | 271.8±25.9 °C |
|---|
Names
| Name | 1-nitro-3-(3-nitrophenyl)sulfonylbenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 525.8±35.0 °C at 760 mmHg |
|---|
| Melting Point | 252-255°C |
|---|
| Molecular Formula | C12H8N2O6S |
|---|
| Molecular Weight | 308.267 |
|---|
| Flash Point | 271.8±25.9 °C |
|---|
| Exact Mass | 308.010315 |
|---|
| PSA | 134.16000 |
|---|
| LogP | 2.85 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | AKAXCFAQCKRJOT-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)c2cccc([N+](=O)[O-])c2)c1 |
|---|
Safety Information
| RTECS | WR4700000 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 3,3'-Dinitrodiphenylsulfone |
| Bis(m-nitrophenyl)sulfone |
| 3,3'-Dinitrodiphenylsulphone |
| Bis-(3-nitro-phenyl)-sulfon |
| 3-NITROPHENYL SULFONE |
| EINECS 214-965-2 |
| 3,3'-sulfonylbis(nitrobenzene) |
| Sulfone,bis(m-nitrophenyl) |
| Bis(3-nitrophenyl)sulfone |
| Sulfone, bis(m-nitrophenyl) |
| 3.3'-Dinitro-diphenylsulfon |
| 1,1'-Sulfonylbis(3-nitrobenzene) |
| 3,3'-dinitrodiphenyl sulfone |
| Benzene, 1,1'-sulfonylbis[3-nitro- |
| MFCD00040973 |
| Bis(3-nitrophenyl) sulfone |
