Introduction：Basic information about CAS 123950-44-7|4-amino-2,6-difluorobenzotrifluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-amino-2,6-difluorobenzotrifluoride |
|---|
| CAS Number | 123950-44-7 | Molecular Weight | 197.10500 |
|---|
| Density | 1.474 g/cm3 | Boiling Point | 103ºC |
|---|
| Molecular Formula | C7H4F5N | Melting Point | 66ºC |
|---|
| MSDS | / | Flash Point | 88.9ºC |
|---|
Names
| Name | 3,5-difluoro-4-(trifluoromethyl)aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.474 g/cm3 |
|---|
| Boiling Point | 103ºC |
|---|
| Melting Point | 66ºC |
|---|
| Molecular Formula | C7H4F5N |
|---|
| Molecular Weight | 197.10500 |
|---|
| Flash Point | 88.9ºC |
|---|
| Exact Mass | 197.02600 |
|---|
| PSA | 26.02000 |
|---|
| LogP | 3.14700 |
|---|
| InChIKey | YJWFKYOOAXZKQA-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(F)c(C(F)(F)F)c(F)c1 |
|---|
Safety Information
| Hazard Codes | T |
|---|
| Risk Phrases | R23/24/25 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 2810 |
|---|
| HS Code | 2921420090 |
|---|
Customs
| HS Code | 2921420090 |
|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-Amino-2,6-difluorobenzotrifluoride |
| AC1LETNU |
| MFCD00190122 |
| 3,5-difluoro-4-(trifluoromethyl)phenylamine |
