Introduction：Basic information about CAS 91307-39-0|ethyl 4-hydroxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 4-hydroxy-2-naphthoate |
|---|
| CAS Number | 91307-39-0 | Molecular Weight | 216.23300 |
|---|
| Density | 1.225g/cm3 | Boiling Point | 401.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 176.7ºC |
|---|
Names
| Name | ethyl 4-hydroxynaphthalene-2-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.225g/cm3 |
|---|
| Boiling Point | 401.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12O3 |
|---|
| Molecular Weight | 216.23300 |
|---|
| Flash Point | 176.7ºC |
|---|
| Exact Mass | 216.07900 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 2.72210 |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | QMCMRBCASLXWFT-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(O)c2ccccc2c1 |
|---|
Synonyms
| ethyl 4-hydroxy-2-naphthoate |
| 2-Naphthalenecarboxylic acid,4-hydroxy-,ethyl ester |
| ethyl 4-hydroxy-naphthalene-2-carboxylate |
| 4-hydroxynaphthalene-2-carboxylic acid ethyl ester |
| ethyl 1-hydroxy-3-naphthylcarboxylate |
| ethyl 1,2,3,4-tetrahydro-4-hydroxy-2-naphthoate |
| 4-hydroxy-[2]naphthoic acid ethyl ester |
