Introduction:Basic information about CAS 40184-38-1|2-(4-aminophenoxy)ethyl hydrogen sulphate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-aminophenoxy)ethyl hydrogen sulphate |
|---|
| CAS Number | 40184-38-1 | Molecular Weight | 233.24200 |
|---|
| Density | 1.484g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H11NO5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-(4-aminophenoxy)ethyl hydrogen sulfate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.484g/cm3 |
|---|
| Molecular Formula | C8H11NO5S |
|---|
| Molecular Weight | 233.24200 |
|---|
| Exact Mass | 233.03600 |
|---|
| PSA | 107.23000 |
|---|
| LogP | 2.12900 |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | JRJFJFUPGABGSY-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(OCCOS(=O)(=O)O)cc1 |
|---|
Synonyms
| EINECS 254-828-4 |
| 2-(4'-Aminophenoxy)ethyl hydrogen sulfate |
| 1-amino-4-(2-sulfooxyethoxy)benzene |
| 2-(4-Aminophenoxy)ethyl hydrogen sulphate |