Introduction:Basic information about CAS 154748-49-9|tert-Butyl 3-oxocyclobutylcarbamate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butyl 3-oxocyclobutylcarbamate |
|---|
| CAS Number | 154748-49-9 | Molecular Weight | 185.220 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 302.1±31.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H15NO3 | Melting Point | 120-125℃ |
|---|
| MSDS | ChineseUSA | Flash Point | 136.5±24.8 °C |
|---|
Names
| Name | tert-Butyl 3-oxocyclobutylcarbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 302.1±31.0 °C at 760 mmHg |
|---|
| Melting Point | 120-125℃ |
|---|
| Molecular Formula | C9H15NO3 |
|---|
| Molecular Weight | 185.220 |
|---|
| Flash Point | 136.5±24.8 °C |
|---|
| Exact Mass | 185.105194 |
|---|
| PSA | 55.40000 |
|---|
| LogP | 0.37 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.474 |
|---|
| InChIKey | FNHPTFKSPUTESA-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC1CC(=O)C1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 52-51/53-36/37/38 |
|---|
| Safety Phrases | 3/9-4-22-26-28-29-35-44 |
|---|
| RIDADR | 3077 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| tert-Butyl (3-oxocyclobutyl)carbamate |
| 3-(Boc-amino)cyclobutanone |
| 3-(tert-Butoxycarbonylamino)-1-cyclobutanone |
| Carbamic acid, N-(3-oxocyclobutyl)-, 1,1-dimethylethyl ester |
| 3-(Boc-amino)-1-cyclobutanone |
| (3-Oxocyclobutyl)carbamic Acid tert-Butyl Ester |
| Tert-butyl3-oxocyclobutylcarbamate |
| 2-Methyl-2-propanyl (3-oxocyclobutyl)carbamate |
| tert-butyl N-(3-oxocyclobutyl)carbamate |