Introduction：Basic information about CAS 512-63-0|Hexaphenylcyclotrisiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Hexaphenylcyclotrisiloxane |
|---|
| CAS Number | 512-63-0 | Molecular Weight | 594.878 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 593.3±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C36H30O3Si3 | Melting Point | 184-188 °C(lit.) |
|---|
| MSDS | / | Flash Point | 251.5±23.0 °C |
|---|
Names
| Name | Hexaphenylcyclotrisiloxane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 593.3±23.0 °C at 760 mmHg |
|---|
| Melting Point | 184-188 °C(lit.) |
|---|
| Molecular Formula | C36H30O3Si3 |
|---|
| Molecular Weight | 594.878 |
|---|
| Flash Point | 251.5±23.0 °C |
|---|
| Exact Mass | 594.150269 |
|---|
| PSA | 27.69000 |
|---|
| LogP | 3.81960 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | VCYDUTCMKSROID-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc([Si]2(c3ccccc3)O[Si](c3ccccc3)(c3ccccc3)O[Si](c3ccccc3)(c3ccccc3)O2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2902909090 |
|---|
Customs
| HS Code | 2902909090 |
|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|---|
Synonyms
| EINECS 208-145-3 |
| 2,2,4,4,6,6-Hexaphenyl-1,3,5,2,4,6-trioxatrisilinane |
| Cyclotrisiloxane, 2,2,4,4,6,6-hexaphenyl- |
| Cyclotrisiloxane, hexaphenyl- |
| MFCD00023110 |
| Hexaphenylcyclotrisiloxane |
| 2,2,4,4,6,6-hexakis-phenyl-1,3,5,2,4,6-trioxatrisilinane |
