Introduction：Basic information about CAS 26040-51-7|bis(2-ethylhexyl) tetrabromophthalate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(2-ethylhexyl) tetrabromophthalate |
|---|
| CAS Number | 26040-51-7 | Molecular Weight | 706.14000 |
|---|
| Density | 1.529 g/cm3 | Boiling Point | 584.8ºC |
|---|
| Molecular Formula | C24H34Br4O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 307.5ºC |
|---|
Names
| Name | bis(2-ethylhexyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.529 g/cm3 |
|---|
| Boiling Point | 584.8ºC |
|---|
| Molecular Formula | C24H34Br4O4 |
|---|
| Molecular Weight | 706.14000 |
|---|
| Flash Point | 307.5ºC |
|---|
| Exact Mass | 701.91900 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 9.48300 |
|---|
| Vapour Pressure | 1.16E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.541 |
|---|
| InChIKey | UUEDINPOVKWVAZ-UHFFFAOYSA-N |
|---|
| SMILES | CCCCC(CC)COC(=O)c1c(Br)c(Br)c(Br)c(Br)c1C(=O)OCC(CC)CCCC |
|---|
Safety Information
Synonyms
| DSSTox_CID_7887 |
| Uniplex FRP 45 |
| Pyronil 45 |
| Bis(2-ethylhexyl) tetrabromophthalate |
| DP 45 |
| bis(2-ethylhexyl) 3,4,5,6-tetrabromophthalate |
| 1,2-Benzenedicarboxylic acid,3,4,5,6-tetrabromo-,1,2-bis(2-ethylhexyl) ester |
| 1,2-Benzenedicarboxylic acid,3,4,5,6-tetrabromo-,bis(2-ethylhexyl) ester |
| 1,2-Benzenedicarboxylic acid, 3,4,5,6-tetrabromo-, 1,2-bis(2-ethylhexyl) ester |
