Introduction：Basic information about CAS 204716-07-4|FMoc-4-Acetyl-L-phenylalanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | FMoc-4-Acetyl-L-phenylalanine |
|---|
| CAS Number | 204716-07-4 | Molecular Weight | 429.465 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 680.0±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H23NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 365.0±31.5 °C |
|---|
Names
| Name | 3-(4-acetylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 680.0±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H23NO5 |
|---|
| Molecular Weight | 429.465 |
|---|
| Flash Point | 365.0±31.5 °C |
|---|
| Exact Mass | 429.157623 |
|---|
| PSA | 92.70000 |
|---|
| LogP | 4.85 |
|---|
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | MKHDZWYAQYTGRJ-DEOSSOPVSA-N |
|---|
| SMILES | CC(=O)c1ccc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1 |
|---|
Synonyms
| Fmoc-D-4-acetylphe |
| Fmoc-4-Acetyl-L-phenylalanine |
| 4-Acetyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-phenylalanine |
| N-Fmoc-L-(p-acetyl-Phe) |
| L-Phenylalanine, 4-acetyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| Fmoc-L-4-Acetylphe |
| FMoc-4-Acetyl-L-phenylalanine |
| Fmoc-L-4-Acetylphenylalanine |
| Boc-D-Phe(4-Ac)-OH |
