Introduction:Basic information about CAS 3011-89-0|Aklomide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Aklomide |
|---|
| CAS Number | 3011-89-0 | Molecular Weight | 200.57900 |
|---|
| Density | 1.52 g/cm3 | Boiling Point | 335.8ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5ClN2O3 | Melting Point | 171-173°C |
|---|
| MSDS | ChineseUSA | Flash Point | 156.9ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-chloro-4-nitrobenzamide |
|---|
| Synonym | More Synonyms |
|---|
Aklomide BiologicalActivity
| Description | Aklomide is used to fight disease, parasites and insects that infest poultry. |
|---|
| Related Catalog | Signaling Pathways >>Anti-infection >>ParasiteResearch Areas >>Infection |
|---|
Chemical & Physical Properties
| Density | 1.52 g/cm3 |
|---|
| Boiling Point | 335.8ºC at 760 mmHg |
|---|
| Melting Point | 171-173°C |
|---|
| Molecular Formula | C7H5ClN2O3 |
|---|
| Molecular Weight | 200.57900 |
|---|
| Flash Point | 156.9ºC |
|---|
| Exact Mass | 199.99900 |
|---|
| PSA | 88.91000 |
|---|
| LogP | 2.57060 |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | GFGSZUNNBQXGMK-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)c1ccc([N+](=O)[O-])cc1Cl |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Benzamide,2-chloro-4-nitro |
| 2-chloro-4-nitro-benzoic acid amide |
| component of Aklomix |
| 2-Chlor-4-nitrobenzamid |
| MFCD00017119 |
| aklomide |
| 2-Chloro-4-nitrobenzamide |
| 2-CHLORO-4-NITRO BENZAMIDE |
| 2-Chloro-4-nitro-benzamid |
| 2-Chlor-4-nitro-benzoesaeure-amid |
| component of Novastat-W |
| Aklomix |
| EINECS 221-143-7 |
| Alkomide |
| Clomide |