Introduction:Basic information about CAS 20330-90-9|Dimethyl 5-chloroisophthalate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dimethyl 5-chloroisophthalate |
|---|
| CAS Number | 20330-90-9 | Molecular Weight | 228.629 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 316.0±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H9ClO4 | Melting Point | 78ºC |
|---|
| MSDS | / | Flash Point | 132.8±21.3 °C |
|---|
Names
| Name | dimethyl 5-chlorobenzene-1,3-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 316.0±22.0 °C at 760 mmHg |
|---|
| Melting Point | 78ºC |
|---|
| Molecular Formula | C10H9ClO4 |
|---|
| Molecular Weight | 228.629 |
|---|
| Flash Point | 132.8±21.3 °C |
|---|
| Exact Mass | 228.018936 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 3.16 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.530 |
|---|
| InChIKey | CMMPMNSOVLQGMJ-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(Cl)cc(C(=O)OC)c1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 20/21/22-36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2917399090 |
|---|
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| CK1105 |
| methyl 5-chloro-1,3-dibenzoate |
| 1,3-Benzenedicarboxylic acid, 5-chloro-, dimethyl ester |
| Dimethyl 5-chloroisophthalate |
| MFCD00079752 |
| 5-Chlor-isophthalsaeure-dimethylester |
| 5-chloro-isophthalic acid dimethyl ester |