Introduction：Basic information about CAS 1460-02-2|1,3,5-Tri-tert-butylbenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3,5-Tri-tert-butylbenzene |
|---|
| CAS Number | 1460-02-2 | Molecular Weight | 246.431 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 248.0±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H30 | Melting Point | 67-72 °C(lit.) |
|---|
| MSDS | / | Flash Point | 99.1±7.3 °C |
|---|
Names
| Name | 1,3,5-Tri-tert-butylbenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 248.0±0.0 °C at 760 mmHg |
|---|
| Melting Point | 67-72 °C(lit.) |
|---|
| Molecular Formula | C18H30 |
|---|
| Molecular Weight | 246.431 |
|---|
| Flash Point | 99.1±7.3 °C |
|---|
| Exact Mass | 246.234756 |
|---|
| LogP | 7.28 |
|---|
| Vapour Pressure | 0.0±0.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.474 |
|---|
| InChIKey | GUFMBISUSZUUCB-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | N |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2902909090 |
|---|
Customs
| HS Code | 2902909090 |
|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|---|
Synonyms
| MFCD00008831 |
| EINECS 215-952-4 |
| 1,3,5-Tris(2-methyl-2-propanyl)benzene |
| 1,3,5-Tris(tert-butyl)benzene |
| 1,3,5-Tris(1,1-dimethylethyl)benzene |
| 1X1&1&R CX1&1&1 EX1&1&1 |
| 1,3,5-tritert-butylbenzene |
| Benzene, 1,3,5-tris(1,1-dimethylethyl)- |
