Introduction：Basic information about CAS 803-19-0|4,4'-(Phenylphosphoryl)dibenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-(Phenylphosphoryl)dibenzoic acid |
|---|
| CAS Number | 803-19-0 | Molecular Weight | 366.304 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 642.9±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H15O5P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 342.6±31.5 °C |
|---|
Names
| Name | 4-[(4-carboxyphenyl)-phenylphosphoryl]benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 642.9±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H15O5P |
|---|
| Molecular Weight | 366.304 |
|---|
| Flash Point | 342.6±31.5 °C |
|---|
| Exact Mass | 366.065704 |
|---|
| PSA | 101.48000 |
|---|
| LogP | 2.22 |
|---|
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.668 |
|---|
| InChIKey | UVTXHAOLTBFLDL-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(P(=O)(c2ccccc2)c2ccc(C(=O)O)cc2)cc1 |
|---|
Synonyms
| 4,4'-(Phenylphosphoryl)dibenzoic acid |
| Benzoic acid, 4-[(4-carboxyphenyl)phenylphosphinyl]- |
| 4,4'-phenylphosphonoyl-di-benzoic acid |
| Phenyl-di-<4-carboxy-phenyl>-phosphinoxyd |
| 4,4'-Phenylphosphonoyl-di-benzoesaeure |
