Introduction:Basic information about CAS 851340-77-7|4-(2-Chloro-5-(trifluoromethyl)phenyl)benzaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(2-Chloro-5-(trifluoromethyl)phenyl)benzaldehyde |
|---|
| CAS Number | 851340-77-7 | Molecular Weight | 225.21800 |
|---|
| Density | 1.265g/cm3 | Boiling Point | 394.629ºC at 760 mmHg |
|---|
| Molecular Formula | C14H8FNO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 192.465ºC |
|---|
Names
| Name | 4-(2-Chloro-5-(trifluoromethyl)phenyl)benzaldehyde |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.265g/cm3 |
|---|
| Boiling Point | 394.629ºC at 760 mmHg |
|---|
| Molecular Formula | C14H8FNO |
|---|
| Molecular Weight | 225.21800 |
|---|
| Flash Point | 192.465ºC |
|---|
| Exact Mass | 225.05900 |
|---|
| PSA | 40.86000 |
|---|
| LogP | 3.17688 |
|---|
| Index of Refraction | 1.602 |
|---|
| InChIKey | BVLBIGPSWJOGCX-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1ccc(-c2ccc(C=O)cc2)cc1F |
|---|
Safety Information
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-(2-Fluoro-4-nitrophenyl)benzaldehyde |
| 3-fluoro-4'-formylbiphenyl-4-carbonitrile |
| 4-(3-Fluoro-5-nitrophenyl)benzaldehyde |
| 4-(3-Cyano-4-fluorophenyl)benzaldehyde |
| 4-(4-Fluoro-2-nitrophenyl)benzaldehyde |
| 4-(2-Cyano-5-fluorophenyl)benzaldehyde |
| 4-(2-Fluoro-5-nitrophenyl)benzaldehyde |
| 4-(4-Cyano-3-fluorophenyl)benzaldehyde |
| 4-(3-Cyano-5-fluorophenyl)benzaldehyde |
| 4-(3-Fluoro-4-nitrophenyl)benzaldehyde |
| 4-(2-Cyano-4-fluorophenyl)benzaldehyde |