Introduction：Basic information about CAS 53967-73-0|2-Methoxy-6-nitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methoxy-6-nitrobenzoic acid |
|---|
| CAS Number | 53967-73-0 | Molecular Weight | 197.145 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 374.6±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H7NO5 | Melting Point | 180ºC |
|---|
| MSDS | / | Flash Point | 180.3±23.7 °C |
|---|
Names
| Name | 2-Methoxy-6-nitrobenzoic Acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 374.6±27.0 °C at 760 mmHg |
|---|
| Melting Point | 180ºC |
|---|
| Molecular Formula | C8H7NO5 |
|---|
| Molecular Weight | 197.145 |
|---|
| Flash Point | 180.3±23.7 °C |
|---|
| Exact Mass | 197.032425 |
|---|
| PSA | 92.35000 |
|---|
| LogP | 1.46 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.588 |
|---|
| InChIKey | ORPBIIFFJYJUHR-UHFFFAOYSA-N |
|---|
| SMILES | COc1cccc([N+](=O)[O-])c1C(=O)O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-Methoxy-6-nitrobenzoic acid |
| Benzoicacid,2-methoxy-6-nitro |
| WNR BVQ CO1 |
| 6-Nitro-o-anisic acid |
| 2-Methoxy-6-nitro-benzoesaeure |
| 6-methoxy-2-nitrobenzoic acid |
| Benzoic acid, 2-methoxy-6-nitro- |
| 2-Methoxy-6-nitrobenzoicAcid |
| 2-Nitro-6-methoxy-benzoesaeure |
| Methylaether-6-nitro-salicylsaeure |
| 2-Nitro-6-methoxybenzoic acid |
