Introduction:Basic information about CAS 204589-82-2|(3R,4S)-3-Azetidinepropanoic acid,1-(4-fluorophenyl)-2-oxo-4[4(phenylmethoxy), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3R,4S)-3-Azetidinepropanoic acid,1-(4-fluorophenyl)-2-oxo-4[4(phenylmethoxy)phenyl]-methyl ester |
|---|
| CAS Number | 204589-82-2 | Molecular Weight | 419.445 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 687.4±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H22FNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 369.6±31.5 °C |
|---|
Names
| Name | 3-[(3R,4S)-1-(4-fluorophenyl)-2-oxo-4-(4-phenylmethoxyphenyl)azetidin-3-yl]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 687.4±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H22FNO4 |
|---|
| Molecular Weight | 419.445 |
|---|
| Flash Point | 369.6±31.5 °C |
|---|
| Exact Mass | 419.153290 |
|---|
| PSA | 66.84000 |
|---|
| LogP | 4.14 |
|---|
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.614 |
|---|
| InChIKey | YOJPXOLPAHAPAQ-ISKFKSNPSA-N |
|---|
| SMILES | O=C(O)CCC1C(=O)N(c2ccc(F)cc2)C1c1ccc(OCc2ccccc2)cc1 |
|---|
Synonyms
| trans-3(R)-3-(2-oxo-4(S)-(4-benzyloxyphenyl)-1-(4-fluorophenyl)-azetidinyl)-propanoic acid |
| (3R,4S)-1-(4-fluorophenyl)-3-[3-(hydroxy)-3-oxopropyl]-4-(4-benzyloxyphenyl)-2-azetidinone |
| 3-[(2S,3R)-2-[4-(Benzyloxy)phenyl]-1-(4-fluorophenyl)-4-oxoazetidin-3-yl]propanoic acid |
| 3-((3R,4S)-1-(4-fluorophenyl)-2-oxo-4-(4-(benzyloxy)phenyl)azetidin-3-yl)propionic acid |
| 3-{(2S,3R)-2-[4-(benzyloxy)phenyl]-1-(4-fluorophenyl)-4-oxoazetidin-3-yl}propionic acid |
| 3-[(2S,3R)-2-[4-(Benzyloxy)phenyl]-1-(4-fluorophenyl)-4-oxo-3-azetidinyl]propanoic acid |
| 3-((2S,3R)-2-(4-(Benzyloxy)phenyl)-1-(4-fluorophenyl)-4-oxoazetidin-3-yl)propanoic acid |
| 3-Azetidinepropanoic acid, 1-(4-fluorophenyl)-2-oxo-4-[4-(phenylmethoxy)phenyl]-, (3R,4S)- |
| Ezetimibe Intermediate-I |