Introduction:Basic information about CAS 211108-50-8|tert-Butyl 3-fluoro-4-oxopiperidine-1-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butyl 3-fluoro-4-oxopiperidine-1-carboxylate |
|---|
| CAS Number | 211108-50-8 | Molecular Weight | 217.237 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 288.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H16FNO3 | Melting Point | 77 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 128.4±27.3 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | tert-butyl 3-fluoro-4-oxopiperidine-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 288.7±40.0 °C at 760 mmHg |
|---|
| Melting Point | 77 °C |
|---|
| Molecular Formula | C10H16FNO3 |
|---|
| Molecular Weight | 217.237 |
|---|
| Flash Point | 128.4±27.3 °C |
|---|
| Exact Mass | 217.111420 |
|---|
| PSA | 46.61000 |
|---|
| LogP | 0.48 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.466 |
|---|
| InChIKey | JZNWQLLPLOQGOI-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C(F)C1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| tert-butyl-3-fluoro-4-oxopiperidine-1-carboxylate |
| 1-Boc-3-fluoro-4-piperidone |
| 1-Piperidinecarboxylic acid, 3-fluoro-4-oxo-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 3-fluoro-4-oxo-1-piperidinecarboxylate |
| 1,1-Dimethylethyl 3-fluoro-4-oxo-1-piperidinecarboxylate |
| tert-Butyl 3-fluoro-4-oxopiperidine-1-carboxylate |
| 1-Boc-3-fluoropiperidin-4-one |
| 3-fluoro-4-oxo-piperidine-1-carboxylic acid tert-butyl ester |
| tert-butyl 1-(4-oxo-3-fluoropiperidin-1-yl)carboxylate |
| 1-(tert-Butoxycarbonyl)-3-fluoro-4-oxopiperidine |
| T6N DVTJ AVOX1&1&1 CF |
| 1-Boc-3-fluoro-4-oxopiperidine |
| 1-(tert-butoxycarbonyl)-3-fluoro-4-piperidone |