Introduction:Basic information about CAS 145-48-2|1,4-Dihydroxyanthraquinone-2-sulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,4-Dihydroxyanthraquinone-2-sulfonic acid |
|---|
| CAS Number | 145-48-2 | Molecular Weight | 320.274 |
|---|
| Density | 1.8±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C14H8O7S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|
| Molecular Formula | C14H8O7S |
|---|
| Molecular Weight | 320.274 |
|---|
| Exact Mass | 319.999084 |
|---|
| PSA | 137.35000 |
|---|
| LogP | 2.47 |
|---|
| Index of Refraction | 1.743 |
|---|
| InChIKey | CCQSBGJULPBARL-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(S(=O)(=O)O)cc(O)c21 |
|---|
Safety Information
| Safety Phrases | S24/25 |
|---|
| RIDADR | UN 1789 8/PG 3 |
|---|
| WGK Germany | 2 |
|---|
| RTECS | MC0560000 |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| MFCD00019147 |
| 2-quinizarinsulphonic acid |
| Quinizarin-3-sulphonic acid |
| 2-sulfoquinizarine |
| 2-Anthracenesulfonic acid, 9,10-dihydro-1,4-dihydroxy-9,10-dioxo- |
| quinizarin-2-sulfonic acid |
| Morocco Maroon X-1550 |
| 1,4-Dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid |
| 1,4-Dihydroxy-9,10-dioxo-9,10-dihydro-2-anthracenesulfonic acid |
| 2-sulpho-1,4-dihydroxyanthraquinone |
| Helio Fast Rubine 4BLA |
| 1,4-Dihydroxyanthraquinone-2-sulfonic acid |
| 9,10-Dihydro-1,4-dihydroxy-9,10-dioxo-2-anthracenesulfonic acid |
| Rufianic acid |
| C.I. Pigment Violet 5 |
| Quinizarinsulfonic acid |
| Quinizarin-3-sulfonic acid |
| EINECS 205-654-2 |
| 1,4-dihydroxy-9,10-dioxo-9,10-dihydro-anthracene-2-sulfonic acid |