Introduction：Basic information about CAS 3563-14-2|Butanoic acid,4-[[4-(aminosulfonyl)phenyl]amino]-4-oxo-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Butanoic acid,4-[[4-(aminosulfonyl)phenyl]amino]-4-oxo- |
|---|
| CAS Number | 3563-14-2 | Molecular Weight | 272.27800 |
|---|
| Density | 1.52g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H12N2O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-oxo-4-(4-sulfamoylanilino)butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.52g/cm3 |
|---|
| Molecular Formula | C10H12N2O5S |
|---|
| Molecular Weight | 272.27800 |
|---|
| Exact Mass | 272.04700 |
|---|
| PSA | 134.94000 |
|---|
| LogP | 1.99140 |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | RXXXPZYBZLDQKP-UHFFFAOYSA-N |
|---|
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CCC(=O)O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| Sulfasuccinamidum |
| Sulfasuccinamide |
| N-(4-Sulfamoyl-phenyl)-succinamidsaeure |
| 4-{3-carboxy-propionylamino}-benzene-1-sulfonamide |
| Succinylsulfanilamide |
| Sulfasuccinamida |
| 4-{3-Carboxy-propionylamino}-benzol-sulfonsaeure-(1)-amid |
| 4-Oxo-4-((4-sulfamoylphenyl)amino)butanoic acid |
| N-(4-sulfamoyl-phenyl)-succinamic acid |
