Introduction：Basic information about CAS 20505-32-2|Oxireno[1,2]azuleno[6,5-b]furan-5(1aH)-one,decahydro-7,8-dihydroxy-2,7a-dimeth, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Oxireno[1,2]azuleno[6,5-b]furan-5(1aH)-one,decahydro-7,8-dihydroxy-2,7a-dimethyl-6- methylene-,(1aR,1bS,2R,3aR,6aS,7S,7aR,8R,- 8aS)- |
|---|
| CAS Number | 20505-32-2 | Molecular Weight | 280.31600 |
|---|
| Density | 1.36g/cm3 | Boiling Point | 505.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H20O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 192.5ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.36g/cm3 |
|---|
| Boiling Point | 505.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H20O5 |
|---|
| Molecular Weight | 280.31600 |
|---|
| Flash Point | 192.5ºC |
|---|
| Exact Mass | 280.13100 |
|---|
| PSA | 79.29000 |
|---|
| LogP | 0.24930 |
|---|
| Vapour Pressure | 2.53E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | NWSWVIKHALGAER-KVLFNOHQSA-N |
|---|
| SMILES | C=C1C(=O)OC2CC(C)C3C4OC4C(O)C3(C)C(O)C12 |
|---|
