Introduction：Basic information about CAS 213967-85-2|Methyl 4-acetoxy-6,8-dimethoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4-acetoxy-6,8-dimethoxy-2-naphthoate |
|---|
| CAS Number | 213967-85-2 | Molecular Weight | 304.29500 |
|---|
| Density | 1.231g/cm3 | Boiling Point | 465.5ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 207.1ºC |
|---|
Names
| Name | Methyl 4-acetoxy-6,8-dimethoxy-2-naphthoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.231g/cm3 |
|---|
| Boiling Point | 465.5ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16O6 |
|---|
| Molecular Weight | 304.29500 |
|---|
| Flash Point | 207.1ºC |
|---|
| Exact Mass | 304.09500 |
|---|
| PSA | 71.06000 |
|---|
| LogP | 2.56890 |
|---|
| Vapour Pressure | 7.64E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | HMJMLRHVMMUYOR-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OC(C)=O)c2cc(OC)cc(OC)c2c1 |
|---|
Synonyms
| 5,7-dimethoxy-3-methoxycarbonyl-1-acetoxynaphthalene |
| 5,7-dimethoxy-3',5'-dinitroflavone |
