Introduction：Basic information about CAS 267881-57-2|Methyl 8-bromo-4-hydroxy-5-isopropoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 8-bromo-4-hydroxy-5-isopropoxy-2-naphthoate |
|---|
| CAS Number | 267881-57-2 | Molecular Weight | 339.18100 |
|---|
| Density | 1.452g/cm3 | Boiling Point | 483.7ºC at 760 mmHg |
|---|
| Molecular Formula | C15H15BrO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 246.3ºC |
|---|
Names
| Name | Methyl 8-bromo-4-hydroxy-5-isopropoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.452g/cm3 |
|---|
| Boiling Point | 483.7ºC at 760 mmHg |
|---|
| Molecular Formula | C15H15BrO4 |
|---|
| Molecular Weight | 339.18100 |
|---|
| Flash Point | 246.3ºC |
|---|
| Exact Mass | 338.01500 |
|---|
| PSA | 55.76000 |
|---|
| LogP | 3.88170 |
|---|
| Vapour Pressure | 5.59E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.613 |
|---|
| InChIKey | LIWNETMLJBSSBB-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(O)c2c(OC(C)C)ccc(Br)c2c1 |
|---|
