Introduction：Basic information about CAS 540779-28-0|Ethyl 4-acetoxy-6-bromo-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-acetoxy-6-bromo-2-naphthoate |
|---|
| CAS Number | 540779-28-0 | Molecular Weight | 337.16500 |
|---|
| Density | 1.455g/cm3 | Boiling Point | 450.744ºC at 760 mmHg |
|---|
| Molecular Formula | C15H13BrO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.402ºC |
|---|
Names
| Name | Ethyl 4-acetoxy-6-bromo-2-naphthoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.455g/cm3 |
|---|
| Boiling Point | 450.744ºC at 760 mmHg |
|---|
| Molecular Formula | C15H13BrO4 |
|---|
| Molecular Weight | 337.16500 |
|---|
| Flash Point | 226.402ºC |
|---|
| Exact Mass | 336.00000 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 3.70430 |
|---|
| Index of Refraction | 1.602 |
|---|
| InChIKey | TXRDONSOAWTHFF-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(OC(C)=O)c2cc(Br)ccc2c1 |
|---|
Synonyms
| ethyl 4-acetoxy-6-bromonaphthalene-2-carboxylate |
| ethyl 1-acetoxy-7-bromo-3-naphthalenecarboxylate |
| 4-Acetoxy-6,8-dimethoxy-2-naphthoesaeureaethylester |
| ethyl 4-acetoxy-6,8-dimethoxynaphthalene-2-carboxylate |
| 4-acetoxy-6,8-dimethoxynaphthalene-2-carboxylic acid ethyl ester |
