Introduction：Basic information about CAS 200418-19-5|4-Bromo-3-[4-(chloromethyl)-3-fluorobenzoyl]-N,N-dimethyl-1H-indo le-1-carbox, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Bromo-3-[4-(chloromethyl)-3-fluorobenzoyl]-N,N-dimethyl-1H-indo le-1-carboxamide |
|---|
| CAS Number | 200418-19-5 | Molecular Weight | 437.69000 |
|---|
| Density | 1.499g/cm3 | Boiling Point | 562.32ºC at 760 mmHg |
|---|
| Molecular Formula | C19H15BrClFN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 293.88ºC |
|---|
Names
| Name | 4-Bromo-3-[4-(chloromethyl)-3-fluorobenzoyl]-N,N-dimethyl-1H-indo le-1-carboxamide |
|---|
Chemical & Physical Properties
| Density | 1.499g/cm3 |
|---|
| Boiling Point | 562.32ºC at 760 mmHg |
|---|
| Molecular Formula | C19H15BrClFN2O2 |
|---|
| Molecular Weight | 437.69000 |
|---|
| Flash Point | 293.88ºC |
|---|
| Exact Mass | 435.99900 |
|---|
| PSA | 42.31000 |
|---|
| LogP | 5.04240 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.629 |
|---|
| InChIKey | GUAPPXJGCWOWAT-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)C(=O)n1cc(C(=O)c2ccc(CCl)c(F)c2)c2c(Br)cccc21 |
|---|
