Introduction:Basic information about CAS 3899-65-8|1-Chloro-4,5-dimethoxy-2-nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Chloro-4,5-dimethoxy-2-nitrobenzene |
|---|
| CAS Number | 3899-65-8 | Molecular Weight | 217.60600 |
|---|
| Density | 1.349g/cm3 | Boiling Point | 336.3ºC at 760 mmHg |
|---|
| Molecular Formula | C8H8ClNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 157.2ºC |
|---|
Names
| Name | 1-Chloro-4,5-dimethoxy-2-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.349g/cm3 |
|---|
| Boiling Point | 336.3ºC at 760 mmHg |
|---|
| Molecular Formula | C8H8ClNO4 |
|---|
| Molecular Weight | 217.60600 |
|---|
| Flash Point | 157.2ºC |
|---|
| Exact Mass | 217.01400 |
|---|
| PSA | 64.28000 |
|---|
| LogP | 2.78860 |
|---|
| Index of Refraction | 1.545 |
|---|
| InChIKey | CPADFRBFGBIDQD-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(Cl)c([N+](=O)[O-])cc1OC |
|---|
Synonyms
| 4-chloro-5-nitroveratrole |
| 3,4-dimethoxy-6-nitrochlorobenzene |
| 5-Chlor-4-nitro-veratrol |
| 2-chloro-4,5-dimethoxynitrobenzene |
| Benzene,1-chloro-4,5-dimethoxy-2-nitro |
| 1-chloranyl-4,5-dimethoxy-2-nitro-benzene |
| 1-chloro-4,5-dimethoxy-2-nitro-benzene |
| 1-Chlor-4,5-dimethoxy-2-nitro-benzol |