Introduction：Basic information about CAS 59326-56-6|3,3'-[1,4-Phenylenebis(oxy)]dianiline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,3'-[1,4-Phenylenebis(oxy)]dianiline |
|---|
| CAS Number | 59326-56-6 | Molecular Weight | 292.332 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 476.2±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H16N2O2 | Melting Point | 97ºC |
|---|
| MSDS | / | Flash Point | 261.7±18.2 °C |
|---|
Names
| Name | 3-[4-(3-aminophenoxy)phenoxy]aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 476.2±30.0 °C at 760 mmHg |
|---|
| Melting Point | 97ºC |
|---|
| Molecular Formula | C18H16N2O2 |
|---|
| Molecular Weight | 292.332 |
|---|
| Flash Point | 261.7±18.2 °C |
|---|
| Exact Mass | 292.121185 |
|---|
| PSA | 70.50000 |
|---|
| LogP | 3.13 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.668 |
|---|
| InChIKey | LBPVOEHZEWAJKQ-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cccc(Oc2ccc(Oc3cccc(N)c3)cc2)c1 |
|---|
Synonyms
| 3,3'-[1,4-Phenylenebis(oxy)]dianiline |
| 1,4-Di(3-aminophenoxy)-Benzene |
| Benzenamine, 3,3'-[1,4-phenylenebis(oxy)]bis- |
| I01-9785 |
| 1,4-BIS(3-AMINOPHENOXY)BENZENE |
