Introduction：Basic information about CAS 7008-15-3|Hydroxindasol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Hydroxindasol |
|---|
| CAS Number | 7008-15-3 | Molecular Weight | 310.39000 |
|---|
| Density | 1.18g/cm3 | Boiling Point | 546.9ºC at 760 mmHg |
|---|
| Molecular Formula | C19H22N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 284.6ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.18g/cm3 |
|---|
| Boiling Point | 546.9ºC at 760 mmHg |
|---|
| Molecular Formula | C19H22N2O2 |
|---|
| Molecular Weight | 310.39000 |
|---|
| Flash Point | 284.6ºC |
|---|
| Exact Mass | 310.16800 |
|---|
| PSA | 60.41000 |
|---|
| LogP | 3.91370 |
|---|
| Index of Refraction | 1.603 |
|---|
| InChIKey | AYYHIZJKRIKWCE-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(Cn2c(C)c(CCN)c3cc(O)ccc32)cc1 |
|---|
