Introduction:Basic information about CAS 21427-62-3|2,5-Dichloro-3-nitropyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-Dichloro-3-nitropyridine |
|---|
| CAS Number | 21427-62-3 | Molecular Weight | 192.988 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 265.3±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C5H2Cl2N2O2 | Melting Point | 39-45 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 114.2±25.9 °C |
|---|
| Symbol | GHS05, GHS06 | Signal Word | Danger |
|---|
Names
| Name | 2,5-Dichloro-3-nitropyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 265.3±35.0 °C at 760 mmHg |
|---|
| Melting Point | 39-45 °C |
|---|
| Molecular Formula | C5H2Cl2N2O2 |
|---|
| Molecular Weight | 192.988 |
|---|
| Flash Point | 114.2±25.9 °C |
|---|
| Exact Mass | 191.949326 |
|---|
| PSA | 58.71000 |
|---|
| LogP | 1.89 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.603 |
|---|
| InChIKey | OBUGJYJQJWMOQO-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc(Cl)cnc1Cl |
|---|
Safety Information
| Symbol | GHS05, GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H315-H318-H335 |
|---|
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
|---|
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | 36/37/38-22-43 |
|---|
| Safety Phrases | S36/37/39-S26 |
|---|
| RIDADR | UN 2811 6.1 / PGIII |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2,5-Dichloro-3-nitropyridine |
| 2,5-dichloro-3-nitro-pyridine |
| 2-amino-5-chloro-3-nitrobenzene |
| T6NJ BG CNW EG |
| 3-nitro-2,5-dichloropyridine |
| 2,5-Dichlor-3-nitro-pyridin |
| MFCD06658963 |
| Pyridine, 2,5-dichloro-3-nitro- |
| 2,5-dichloronitropyridine |