Introduction：Basic information about CAS 5413-05-8|Ethyl 3-oxo-4-phenylbutanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 3-oxo-4-phenylbutanoate |
|---|
| CAS Number | 5413-05-8 | Molecular Weight | 206.238 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 290.3±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H14O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 123.9±20.4 °C |
|---|
Names
| Name | ethyl 3-oxo-2-phenylbutanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 290.3±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H14O3 |
|---|
| Molecular Weight | 206.238 |
|---|
| Flash Point | 123.9±20.4 °C |
|---|
| Exact Mass | 206.094299 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.45 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.506 |
|---|
| InChIKey | PWRUKIPYVGHRFL-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(C(C)=O)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S24/25 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 3-oxo-4-phenyl-butyric acid ethyl ester |
| ethyl 2-phenyl-3-oxobutanoate |
| Ethyl 2-phenylacetoacetate |
| Ethyl acetylphenylacetate |
| EINECS 226-500-0 |
| Benzenebutanoic acid, β-oxo-, ethyl ester |
| MFCD00040490 |
| 3-oxo-2-phenylbutyric acid ethyl ester |
| ethyl 2-phenyl-acetoacetate |
| 2-fenil-3-oxobutanoato di etile |
| Ethyl 3-oxo-4-phenylbutanoate |
