Introduction:Basic information about CAS 51655-71-1|5-methyl-2-phenyl-1,3-oxazole-4-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-methyl-2-phenyl-1,3-oxazole-4-carbonyl chloride |
|---|
| CAS Number | 51655-71-1 | Molecular Weight | 221.64000 |
|---|
| Density | 1.278g/cm3 | Boiling Point | 346.4ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8ClNO2 | Melting Point | 135ºC |
|---|
| MSDS | / | Flash Point | 163.3ºC |
|---|
Names
| Name | 5-methyl-2-phenyl-1,3-oxazole-4-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.278g/cm3 |
|---|
| Boiling Point | 346.4ºC at 760 mmHg |
|---|
| Melting Point | 135ºC |
|---|
| Molecular Formula | C11H8ClNO2 |
|---|
| Molecular Weight | 221.64000 |
|---|
| Flash Point | 163.3ºC |
|---|
| Exact Mass | 221.02400 |
|---|
| PSA | 43.10000 |
|---|
| LogP | 3.02900 |
|---|
| Index of Refraction | 1.562 |
|---|
| InChIKey | RWVAPUPMWDZLGV-UHFFFAOYSA-N |
|---|
| SMILES | Cc1oc(-c2ccccc2)nc1C(=O)Cl |
|---|
Safety Information
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-methyl-2-phenyl-4-oxazolecarboxylic acid chloride |
| 2-phenyl-5-methyl-4-oxazolecarboxylic acid chloride |
| 5-Methyl-2-phenyl-oxazol-4-carbonylchlorid |
| 5-methyl-2-phenyl-oxazole-4-carbonyl chloride |
| 2-phenyl-5-methyl-oxazole-4-carboxyl chloride |