Introduction:Basic information about CAS 879896-39-6|1-(4-isocyanatophenyl)-4-methylpiperazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-isocyanatophenyl)-4-methylpiperazine |
|---|
| CAS Number | 879896-39-6 | Molecular Weight | 217.26700 |
|---|
| Density | 1.13g/cm3 | Boiling Point | 145ºC |
|---|
| Molecular Formula | C12H15N3O | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 158.6ºC |
|---|
Names
| Name | 1-(4-isocyanatophenyl)-4-methylpiperazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.13g/cm3 |
|---|
| Boiling Point | 145ºC |
|---|
| Molecular Formula | C12H15N3O |
|---|
| Molecular Weight | 217.26700 |
|---|
| Flash Point | 158.6ºC |
|---|
| Exact Mass | 217.12200 |
|---|
| PSA | 35.91000 |
|---|
| LogP | 1.40860 |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | HUJDWVCICJKNQJ-UHFFFAOYSA-N |
|---|
| SMILES | CN1CCN(c2ccc(N=C=O)cc2)CC1 |
|---|
Synonyms