Introduction：Basic information about CAS 7505-73-9|1-(2-phenylquinolin-4-yl)ethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(2-phenylquinolin-4-yl)ethanone |
|---|
| CAS Number | 7505-73-9 | Molecular Weight | 247.29100 |
|---|
| Density | 1.157g/cm3 | Boiling Point | 439.3ºC at 760 mmHg |
|---|
| Molecular Formula | C17H13NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 224.5ºC |
|---|
Names
| Name | 1-(2-phenylquinolin-4-yl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.157g/cm3 |
|---|
| Boiling Point | 439.3ºC at 760 mmHg |
|---|
| Molecular Formula | C17H13NO |
|---|
| Molecular Weight | 247.29100 |
|---|
| Flash Point | 224.5ºC |
|---|
| Exact Mass | 247.10000 |
|---|
| PSA | 29.96000 |
|---|
| LogP | 4.10440 |
|---|
| Index of Refraction | 1.638 |
|---|
| InChIKey | OVNIWCRPJILPRK-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1cc(-c2ccccc2)nc2ccccc12 |
|---|
Synonyms
| 2-Phenyl-4-acetylquinoline |
| Ketone,methyl 2-phenyl-4-quinolyl |
| 1-(2-Phenyl-4-quinolinyl)ethanone |
