Introduction：Basic information about CAS 2159-38-8|Benzoicacid, 2-(3-nitrobenzoyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoicacid, 2-(3-nitrobenzoyl)- |
|---|
| CAS Number | 2159-38-8 | Molecular Weight | 271.22500 |
|---|
| Density | 1.413g/cm3 | Boiling Point | 517.4ºC at 760mmHg |
|---|
| Molecular Formula | C14H9NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220.5ºC |
|---|
Names
| Name | 2-(3-nitrobenzoyl)benzoic acid |
|---|
Chemical & Physical Properties
| Density | 1.413g/cm3 |
|---|
| Boiling Point | 517.4ºC at 760mmHg |
|---|
| Molecular Formula | C14H9NO5 |
|---|
| Molecular Weight | 271.22500 |
|---|
| Flash Point | 220.5ºC |
|---|
| Exact Mass | 271.04800 |
|---|
| PSA | 100.19000 |
|---|
| LogP | 3.04720 |
|---|
| Vapour Pressure | 1.56E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.644 |
|---|
| InChIKey | SQDUMZPMFYAAOC-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccccc1C(=O)c1cccc([N+](=O)[O-])c1 |
|---|
