Introduction:Basic information about CAS 2103-98-2|2(3H)-Thiazolone,4-(4-chlorophenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2(3H)-Thiazolone,4-(4-chlorophenyl)- |
|---|
| CAS Number | 2103-98-2 | Molecular Weight | 211.66800 |
|---|
| Density | 1.428g/cm3 | Boiling Point | 410.2ºC at 760mmHg |
|---|
| Molecular Formula | C9H6ClNOS | Melting Point | 222-226ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 201.9ºC |
|---|
| Symbol | GHS05, GHS06 | Signal Word | Danger |
|---|
Names
| Name | 4-(4-chlorophenyl)-3H-1,3-thiazol-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.428g/cm3 |
|---|
| Boiling Point | 410.2ºC at 760mmHg |
|---|
| Melting Point | 222-226ºC |
|---|
| Molecular Formula | C9H6ClNOS |
|---|
| Molecular Weight | 211.66800 |
|---|
| Flash Point | 201.9ºC |
|---|
| Exact Mass | 210.98600 |
|---|
| PSA | 61.10000 |
|---|
| LogP | 2.75680 |
|---|
| Vapour Pressure | 2.58E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.655 |
|---|
| InChIKey | XODFWCAVOQHJFC-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH]c(-c2ccc(Cl)cc2)cs1 |
|---|
Safety Information
| Symbol | GHS05, GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H315-H318-H335 |
|---|
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | R22 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 2811 6.1/PG 3 |
|---|
| HS Code | 2934100090 |
|---|
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 4-(4-chlorophenyl)-2-oxo-1,3-thiazole |
| 4-p-Chlorphenyl-4-thiazolin-2-on |
| (4-chlorophenyl)-2(3H)-thiazolone |
| 4-(4-Chlor-phenyl)-3H-thiazol-2-on |
| 4-(4-chloro-phenyl)-3H-thiazol-2-one |
| 4-(4-CHLOROPHENYL)-2-HYDROXYTHIAZOLE |
| 2-thiazolol,4-(4-chlorophenyl) |
| 4-(4-chlorophenyl)-2-oxo-thiazole |